C13H14ClF3N2S — CID 106431900
2-(1-chloroethyl)-7-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazole (PubChem CID 106431900) has the molecular formula C13H14ClF3N2S and a molecular weight of 322.78 g/mol. Its IUPAC name is 2-(1-chloroethyl)-7-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazole.
| Compound Name | 2-(1-chloroethyl)-7-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 106431900 |
| Molecular Formula | C13H14ClF3N2S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-(1-chloroethyl)-7-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazole |
| SMILES | Cc1cccc2nc(C(C)Cl)n(CCSC(F)(F)F)c12 |
| InChI | InChI=1S/C13H14ClF3N2S/c1-8-4-3-5-10-11(8)19(12(18-10)9(2)14)6-7-20-13(15,16)17/h3-5,9H,6-7H2,1-2H3 |
| InChIKey | FGMQHFAKZKEGOR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|