C10H13ClF3N3OS — CID 106432075
6-chloro-2-(ethoxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine (PubChem CID 106432075) has the molecular formula C10H13ClF3N3OS and a molecular weight of 315.75 g/mol. Its IUPAC name is 6-chloro-2-(ethoxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(ethoxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106432075 |
| Molecular Formula | C10H13ClF3N3OS |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 6-chloro-2-(ethoxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine |
| SMILES | CCOCc1nc(Cl)cc(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13ClF3N3OS/c1-2-18-6-9-16-7(11)5-8(17-9)15-3-4-19-10(12,13)14/h5H,2-4,6H2,1H3,(H,15,16,17) |
| InChIKey | KHHCSLAOMZCTTN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|