About 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine
6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine (PubChem CID 106432081) has the molecular formula C9H11ClF3N3S
and a molecular weight of 285.72 g/mol. Its IUPAC name is 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine |
| PubChem CID | 106432081 |
| Molecular Formula | C9H11ClF3N3S |
| Molecular Weight | 285.72 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1nc(Cl)c(C)c(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C9H11ClF3N3S/c1-5-7(10)15-6(2)16-8(5)14-3-4-17-9(11,12)13/h3-4H2,1-2H3,(H,14,15,16) |
| InChIKey | QRZYNNHVNSFRAL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine?
The IUPAC name of 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine (CID 106432081) is 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine.
What is the SMILES notation for 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine?
The canonical SMILES for 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine is Cc1nc(Cl)c(C)c(NCCSC(F)(F)F)n1.
What is the InChIKey of 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine?
The InChIKey is QRZYNNHVNSFRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClF3N3S/c1-5-7(10)15-6(2)16-8(5)14-3-4-17-9(11,12)13/h3-4H2,1-2H3,(H,14,15,16).
What are the key properties of 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine?
6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine has a molecular weight of 285.72 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine is sourced from PubChem (CID 106432081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).