About 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide
2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide (PubChem CID 106432173) has the molecular formula C10H18F3N3O2S
and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide.
Molecular Properties
| Compound Name | 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide |
| PubChem CID | 106432173 |
| Molecular Formula | C10H18F3N3O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide |
| SMILES | CCC(CC)(C(=O)NCCSC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C10H18F3N3O2S/c1-3-9(4-2,7(14)16-18)8(17)15-5-6-19-10(11,12)13/h18H,3-6H2,1-2H3,(H2,14,16)(H,15,17) |
| InChIKey | XBGMQKBDFYNELG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide?
The IUPAC name of 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide (CID 106432173) is 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide.
What is the SMILES notation for 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide?
The canonical SMILES for 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide is CCC(CC)(C(=O)NCCSC(F)(F)F)C(N)=NO.
What is the InChIKey of 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide?
The InChIKey is XBGMQKBDFYNELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N3O2S/c1-3-9(4-2,7(14)16-18)8(17)15-5-6-19-10(11,12)13/h18H,3-6H2,1-2H3,(H2,14,16)(H,15,17).
What are the key properties of 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide?
2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide has a molecular weight of 301.33 g/mol, XLogP of 1.91, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(trifluoromethylsulfanyl)ethyl]butanamide is sourced from PubChem (CID 106432173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).