C7H9F3N4OS — CID 106432366
5-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 106432366) has the molecular formula C7H9F3N4OS and a molecular weight of 254.24 g/mol. Its IUPAC name is 5-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 106432366 |
| Molecular Formula | C7H9F3N4OS |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NCCSC(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C7H9F3N4OS/c1-4-12-5(14-13-4)6(15)11-2-3-16-7(8,9)10/h2-3H2,1H3,(H,11,15)(H,12,13,14) |
| InChIKey | BJAUPXOJQIPGNI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|