C8H9F3N2O2S2 — CID 106433137
3-methyl-5-[2-(trifluoromethylsulfanyl)ethylamino]-1,2-thiazole-4-carboxylic acid (PubChem CID 106433137) has the molecular formula C8H9F3N2O2S2 and a molecular weight of 286.30 g/mol. Its IUPAC name is 3-methyl-5-[2-(trifluoromethylsulfanyl)ethylamino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-methyl-5-[2-(trifluoromethylsulfanyl)ethylamino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106433137 |
| Molecular Formula | C8H9F3N2O2S2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 3-methyl-5-[2-(trifluoromethylsulfanyl)ethylamino]-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(NCCSC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C8H9F3N2O2S2/c1-4-5(7(14)15)6(17-13-4)12-2-3-16-8(9,10)11/h12H,2-3H2,1H3,(H,14,15) |
| InChIKey | UPFUWARODCDBLJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|