C8H10F5NOS — CID 106433397
2,2,3,3,3-pentafluoro-N-(2-prop-2-enylsulfanylethyl)propanamide (PubChem CID 106433397) has the molecular formula C8H10F5NOS and a molecular weight of 263.23 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(2-prop-2-enylsulfanylethyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(2-prop-2-enylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 106433397 |
| Molecular Formula | C8H10F5NOS |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(2-prop-2-enylsulfanylethyl)propanamide |
| SMILES | C=CCSCCNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F5NOS/c1-2-4-16-5-3-14-6(15)7(9,10)8(11,12)13/h2H,1,3-5H2,(H,14,15) |
| InChIKey | YDWBGZNJAINQJT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|