C10H11F3N2O3S — CID 106433464
8-[2-(trifluoromethylsulfanyl)ethyl]-6,8-diazaspiro[3.5]nonane-5,7,9-trione (PubChem CID 106433464) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is 8-[2-(trifluoromethylsulfanyl)ethyl]-6,8-diazaspiro[3.5]nonane-5,7,9-trione.
| Compound Name | 8-[2-(trifluoromethylsulfanyl)ethyl]-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
|---|---|
| PubChem CID | 106433464 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 8-[2-(trifluoromethylsulfanyl)ethyl]-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
| SMILES | O=C1NC(=O)C2(CCC2)C(=O)N1CCSC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O3S/c11-10(12,13)19-5-4-15-7(17)9(2-1-3-9)6(16)14-8(15)18/h1-5H2,(H,14,16,18) |
| InChIKey | GUAMHGDCFWHEDO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|