C15H16F3NOS — CID 106434786
1-thiophen-3-yl-2-[(3,3,3-trifluoro-1-phenylpropyl)amino]ethanol (PubChem CID 106434786) has the molecular formula C15H16F3NOS and a molecular weight of 315.36 g/mol. Its IUPAC name is 1-thiophen-3-yl-2-[(3,3,3-trifluoro-1-phenylpropyl)amino]ethanol.
| Compound Name | 1-thiophen-3-yl-2-[(3,3,3-trifluoro-1-phenylpropyl)amino]ethanol |
|---|---|
| PubChem CID | 106434786 |
| Molecular Formula | C15H16F3NOS |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-thiophen-3-yl-2-[(3,3,3-trifluoro-1-phenylpropyl)amino]ethanol |
| SMILES | OC(CNC(CC(F)(F)F)c1ccccc1)c1ccsc1 |
| InChI | InChI=1S/C15H16F3NOS/c16-15(17,18)8-13(11-4-2-1-3-5-11)19-9-14(20)12-6-7-21-10-12/h1-7,10,13-14,19-20H,8-9H2 |
| InChIKey | NDRKILZTMPHLDM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |