C20H28O7 — CID 10643490
4-[[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl]oxy]-4-oxobutanoic acid (PubChem CID 10643490) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-[[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10643490 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-[[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl]oxy]-4-oxobutanoic acid |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](OC(=O)CCC(=O)O)C[C@H]2[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C20H28O7/c1-13-5-3-2-4-6-14-11-15(27-20(25)10-8-18(22)23)12-16(14)17(21)7-9-19(24)26-13/h4,6-7,9,13-17,21H,2-3,5,8,10-12H2,1H3,(H,22,23)/b6-4+,9-7+/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | IXNGCUAZCXPKBG-JINLWZCSSA-N |
| XLogP | 2.38 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|