C12H11NO4S — CID 106436177
N-(2-hydroxy-2-thiophen-3-ylethyl)-6-oxopyran-3-carboxamide (PubChem CID 106436177) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-6-oxopyran-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 106436177 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-6-oxopyran-3-carboxamide |
| SMILES | O=C(NCC(O)c1ccsc1)c1ccc(=O)oc1 |
| InChI | InChI=1S/C12H11NO4S/c14-10(9-3-4-18-7-9)5-13-12(16)8-1-2-11(15)17-6-8/h1-4,6-7,10,14H,5H2,(H,13,16) |
| InChIKey | VMHCJECFTVYJES-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |