C10H10ClF2N — CID 106437391
N-[(Z)-3-chloro-2-methylprop-2-enyl]-3,5-difluoroaniline (PubChem CID 106437391) has the molecular formula C10H10ClF2N and a molecular weight of 217.65 g/mol. Its IUPAC name is N-[(Z)-3-chloro-2-methylprop-2-enyl]-3,5-difluoroaniline.
| Compound Name | N-[(Z)-3-chloro-2-methylprop-2-enyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 106437391 |
| Molecular Formula | C10H10ClF2N |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | N-[(Z)-3-chloro-2-methylprop-2-enyl]-3,5-difluoroaniline |
| SMILES | C/C(=C/Cl)CNc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H10ClF2N/c1-7(5-11)6-14-10-3-8(12)2-9(13)4-10/h2-5,14H,6H2,1H3/b7-5- |
| InChIKey | SNTRKSCBMRSCRL-ALCCZGGFSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |