About 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine
3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine (PubChem CID 106437541) has the molecular formula C9H16ClNO2S
and a molecular weight of 237.75 g/mol. Its IUPAC name is 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine |
| PubChem CID | 106437541 |
| Molecular Formula | C9H16ClNO2S |
| Molecular Weight | 237.75 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine |
| SMILES | CC(=CCl)CNCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16ClNO2S/c1-8(4-10)5-11-6-9-2-3-14(12,13)7-9/h4,9,11H,2-3,5-7H2,1H3 |
| InChIKey | NODBGASMSOIJLV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine?
The IUPAC name of 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine (CID 106437541) is 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine.
What is the SMILES notation for 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine?
The canonical SMILES for 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine is CC(=CCl)CNCC1CCS(=O)(=O)C1.
What is the InChIKey of 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine?
The InChIKey is NODBGASMSOIJLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClNO2S/c1-8(4-10)5-11-6-9-2-3-14(12,13)7-9/h4,9,11H,2-3,5-7H2,1H3.
What are the key properties of 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine?
3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine has a molecular weight of 237.75 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylprop-2-en-1-amine is sourced from PubChem (CID 106437541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).