About N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine
N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine (PubChem CID 106438232) has the molecular formula C10H18ClNO
and a molecular weight of 203.71 g/mol. Its IUPAC name is N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine |
| PubChem CID | 106438232 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine |
| SMILES | CC(=CCl)CNC1(C)CCOC1C |
| InChI | InChI=1S/C10H18ClNO/c1-8(6-11)7-12-10(3)4-5-13-9(10)2/h6,9,12H,4-5,7H2,1-3H3 |
| InChIKey | QGUNHDDBDWPSNV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine?
The IUPAC name of N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine (CID 106438232) is N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine.
What is the SMILES notation for N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine?
The canonical SMILES for N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine is CC(=CCl)CNC1(C)CCOC1C.
What is the InChIKey of N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine?
The InChIKey is QGUNHDDBDWPSNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClNO/c1-8(6-11)7-12-10(3)4-5-13-9(10)2/h6,9,12H,4-5,7H2,1-3H3.
What are the key properties of N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine?
N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine has a molecular weight of 203.71 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-2-methylprop-2-enyl)-2,3-dimethyloxolan-3-amine is sourced from PubChem (CID 106438232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).