About [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol
[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol (PubChem CID 10643825) has the molecular formula C26H27NO2
and a molecular weight of 385.51 g/mol. Its IUPAC name is [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol.
Molecular Properties
| Compound Name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol |
| PubChem CID | 10643825 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol |
| SMILES | CC(C)(C)[C@H]1COC(c2ccccc2C(O)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C26H27NO2/c1-25(2,3)23-18-29-24(27-23)21-16-10-11-17-22(21)26(28,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-17,23,28H,18H2,1-3H3/t23-/m1/s1 |
| InChIKey | IUSPQLHCSDGYIF-HSZRJFAPSA-N |
| XLogP | 5.16 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol?
The IUPAC name of [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol (CID 10643825) is [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol.
What is the SMILES notation for [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol?
The canonical SMILES for [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol is CC(C)(C)[C@H]1COC(c2ccccc2C(O)(c2ccccc2)c2ccccc2)=N1.
What is the InChIKey of [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol?
The InChIKey is IUSPQLHCSDGYIF-HSZRJFAPSA-N. The full InChI is InChI=1S/C26H27NO2/c1-25(2,3)23-18-29-24(27-23)21-16-10-11-17-22(21)26(28,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-17,23,28H,18H2,1-3H3/t23-/m1/s1.
What are the key properties of [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol?
[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol has a molecular weight of 385.51 g/mol, XLogP of 5.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylmethanol is sourced from PubChem (CID 10643825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).