C13H25ClN2 — CID 106438717
N-[[1-(3-chloro-2-methylprop-2-enyl)piperidin-2-yl]methyl]propan-1-amine (PubChem CID 106438717) has the molecular formula C13H25ClN2 and a molecular weight of 244.81 g/mol. Its IUPAC name is N-[[1-(3-chloro-2-methylprop-2-enyl)piperidin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(3-chloro-2-methylprop-2-enyl)piperidin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106438717 |
| Molecular Formula | C13H25ClN2 |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N-[[1-(3-chloro-2-methylprop-2-enyl)piperidin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCN1CC(C)=CCl |
| InChI | InChI=1S/C13H25ClN2/c1-3-7-15-10-13-6-4-5-8-16(13)11-12(2)9-14/h9,13,15H,3-8,10-11H2,1-2H3 |
| InChIKey | JAYBZMWUMVMONZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|