C15H29ClN2 — CID 106440446
5-butan-2-yl-1-(3-chloro-2-methylprop-2-enyl)-2-ethyl-2-methylpiperazine (PubChem CID 106440446) has the molecular formula C15H29ClN2 and a molecular weight of 272.86 g/mol. Its IUPAC name is 5-butan-2-yl-1-(3-chloro-2-methylprop-2-enyl)-2-ethyl-2-methylpiperazine.
| Compound Name | 5-butan-2-yl-1-(3-chloro-2-methylprop-2-enyl)-2-ethyl-2-methylpiperazine |
|---|---|
| PubChem CID | 106440446 |
| Molecular Formula | C15H29ClN2 |
| Molecular Weight | 272.86 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 5-butan-2-yl-1-(3-chloro-2-methylprop-2-enyl)-2-ethyl-2-methylpiperazine |
| SMILES | CCC(C)C1CN(CC(C)=CCl)C(C)(CC)CN1 |
| InChI | InChI=1S/C15H29ClN2/c1-6-13(4)14-10-18(9-12(3)8-16)15(5,7-2)11-17-14/h8,13-14,17H,6-7,9-11H2,1-5H3 |
| InChIKey | MQKKNIHYVNFIBO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |