C11H15ClO3 — CID 106440871
2-(3-chloro-2-methylprop-2-enyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 106440871) has the molecular formula C11H15ClO3 and a molecular weight of 230.69 g/mol. Its IUPAC name is 2-(3-chloro-2-methylprop-2-enyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 2-(3-chloro-2-methylprop-2-enyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 106440871 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-(3-chloro-2-methylprop-2-enyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(=CCl)CC1(C(=O)O)CC2CCC1O2 |
| InChI | InChI=1S/C11H15ClO3/c1-7(6-12)4-11(10(13)14)5-8-2-3-9(11)15-8/h6,8-9H,2-5H2,1H3,(H,13,14) |
| InChIKey | PTGLJLHMSWDASZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |