C14H24ClNO — CID 106440953
2-[1-(3-chloro-2-methylprop-2-enyl)piperidin-2-yl]cyclopentan-1-ol (PubChem CID 106440953) has the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. Its IUPAC name is 2-[1-(3-chloro-2-methylprop-2-enyl)piperidin-2-yl]cyclopentan-1-ol.
| Compound Name | 2-[1-(3-chloro-2-methylprop-2-enyl)piperidin-2-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106440953 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.80 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-[1-(3-chloro-2-methylprop-2-enyl)piperidin-2-yl]cyclopentan-1-ol |
| SMILES | CC(=CCl)CN1CCCCC1C1CCCC1O |
| InChI | InChI=1S/C14H24ClNO/c1-11(9-15)10-16-8-3-2-6-13(16)12-5-4-7-14(12)17/h9,12-14,17H,2-8,10H2,1H3 |
| InChIKey | HYODZWCRNIAYRA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |