C21H18N4O2S — CID 10644114
N-[(E)-(4-methoxyphenyl)methylideneamino]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide (PubChem CID 10644114) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[(E)-(4-methoxyphenyl)methylideneamino]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide.
| Compound Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 10644114 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)Cc2csc3nc(-c4ccccc4)cn23)cc1 |
| InChI | InChI=1S/C21H18N4O2S/c1-27-18-9-7-15(8-10-18)12-22-24-20(26)11-17-14-28-21-23-19(13-25(17)21)16-5-3-2-4-6-16/h2-10,12-14H,11H2,1H3,(H,24,26)/b22-12+ |
| InChIKey | CDWUPSSRFRXLAD-WSDLNYQXSA-N |
| XLogP | 3.76 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|