C9H12ClF4NO — CID 106441937
N-(2-chlorocyclohexyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 106441937) has the molecular formula C9H12ClF4NO and a molecular weight of 261.65 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2-chlorocyclohexyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 106441937 |
| Molecular Formula | C9H12ClF4NO |
| Molecular Weight | 261.65 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | N-(2-chlorocyclohexyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NC1CCCCC1Cl)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H12ClF4NO/c10-5-3-1-2-4-6(5)15-8(16)9(13,14)7(11)12/h5-7H,1-4H2,(H,15,16) |
| InChIKey | FNLOWBQMICRZDD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|