C22H20N2O3S — CID 10644224
(5Z)-5-[[4-[2-(2,3-dimethylindol-1-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10644224) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-(2,3-dimethylindol-1-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-(2,3-dimethylindol-1-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10644224 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (5Z)-5-[[4-[2-(2,3-dimethylindol-1-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)n(CCOc2ccc(/C=C3\SC(=O)NC3=O)cc2)c2ccccc12 |
| InChI | InChI=1S/C22H20N2O3S/c1-14-15(2)24(19-6-4-3-5-18(14)19)11-12-27-17-9-7-16(8-10-17)13-20-21(25)23-22(26)28-20/h3-10,13H,11-12H2,1-2H3,(H,23,25,26)/b20-13- |
| InChIKey | LRTLFCHNROCCNC-MOSHPQCFSA-N |
| XLogP | 4.66 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|