C12H24N2O4S2 — CID 106442246
(2R)-2-amino-3-methyl-3-[(1-methylsulfonylpiperidin-3-yl)methylsulfanyl]butanoic acid (PubChem CID 106442246) has the molecular formula C12H24N2O4S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-3-[(1-methylsulfonylpiperidin-3-yl)methylsulfanyl]butanoic acid.
| Compound Name | (2R)-2-amino-3-methyl-3-[(1-methylsulfonylpiperidin-3-yl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 106442246 |
| Molecular Formula | C12H24N2O4S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (2R)-2-amino-3-methyl-3-[(1-methylsulfonylpiperidin-3-yl)methylsulfanyl]butanoic acid |
| SMILES | CC(C)(SCC1CCCN(S(C)(=O)=O)C1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H24N2O4S2/c1-12(2,10(13)11(15)16)19-8-9-5-4-6-14(7-9)20(3,17)18/h9-10H,4-8,13H2,1-3H3,(H,15,16)/t9?,10-/m1/s1 |
| InChIKey | LDFBCOUQYJGYIO-QVDQXJPCSA-N |
| XLogP | 0.58 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |