C24H27NO4 — CID 10644289
6-butyl-3,9,10-trimethoxy-5,6-dihydroindolo[2,1-a]isoquinoline-12-carbaldehyde (PubChem CID 10644289) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 6-butyl-3,9,10-trimethoxy-5,6-dihydroindolo[2,1-a]isoquinoline-12-carbaldehyde.
| Compound Name | 6-butyl-3,9,10-trimethoxy-5,6-dihydroindolo[2,1-a]isoquinoline-12-carbaldehyde |
|---|---|
| PubChem CID | 10644289 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 6-butyl-3,9,10-trimethoxy-5,6-dihydroindolo[2,1-a]isoquinoline-12-carbaldehyde |
| SMILES | CCCCC1Cc2cc(OC)ccc2-c2c(C=O)c3cc(OC)c(OC)cc3n21 |
| InChI | InChI=1S/C24H27NO4/c1-5-6-7-16-10-15-11-17(27-2)8-9-18(15)24-20(14-26)19-12-22(28-3)23(29-4)13-21(19)25(16)24/h8-9,11-14,16H,5-7,10H2,1-4H3 |
| InChIKey | BPWCDLDCPIHXPD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|