C16H31IOSi — CID 10644330
tert-butyl-[(2E,6E)-8-iodo-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane (PubChem CID 10644330) has the molecular formula C16H31IOSi and a molecular weight of 394.41 g/mol. Its IUPAC name is tert-butyl-[(2E,6E)-8-iodo-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6E)-8-iodo-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10644330 |
| Molecular Formula | C16H31IOSi |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | tert-butyl-[(2E,6E)-8-iodo-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane |
| SMILES | C/C(=C\CC/C(C)=C/CO[Si](C)(C)C(C)(C)C)CI |
| InChI | InChI=1S/C16H31IOSi/c1-14(9-8-10-15(2)13-17)11-12-18-19(6,7)16(3,4)5/h10-11H,8-9,12-13H2,1-7H3/b14-11+,15-10+ |
| InChIKey | UUNCGLHDAMHNFQ-QYFSLLALSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|