C22H36O6 — CID 10644449
(1R,4R)-2,3,5-tris(2-methoxyethoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene (PubChem CID 10644449) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is (1R,4R)-2,3,5-tris(2-methoxyethoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (1R,4R)-2,3,5-tris(2-methoxyethoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 10644449 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (1R,4R)-2,3,5-tris(2-methoxyethoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene |
| SMILES | COCCOCC1=C[C@H]2C(COCCOC)=C(COCCOC)[C@@H]1C2=C(C)C |
| InChI | InChI=1S/C22H36O6/c1-16(2)21-18-12-17(13-26-9-6-23-3)22(21)20(15-28-11-8-25-5)19(18)14-27-10-7-24-4/h12,18,22H,6-11,13-15H2,1-5H3/t18-,22+/m0/s1 |
| InChIKey | OVWKUKMFIBITMT-PGRDOPGGSA-N |
| XLogP | 2.79 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|