C14H25BrN4S — CID 106444980
N-[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(4-methylthiomorpholin-3-yl)methyl]ethanamine (PubChem CID 106444980) has the molecular formula C14H25BrN4S and a molecular weight of 361.35 g/mol. Its IUPAC name is N-[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(4-methylthiomorpholin-3-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(4-methylthiomorpholin-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106444980 |
| Molecular Formula | C14H25BrN4S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(4-methylthiomorpholin-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1c(Br)cnn1C(C)C)C1CSCCN1C |
| InChI | InChI=1S/C14H25BrN4S/c1-5-16-13(12-9-20-7-6-18(12)4)14-11(15)8-17-19(14)10(2)3/h8,10,12-13,16H,5-7,9H2,1-4H3 |
| InChIKey | NLXKOSSNQCSQDV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |