C12H24N2S — CID 106445158
N-ethyl-3-methyl-1-(4-methylthiomorpholin-3-yl)but-2-en-1-amine (PubChem CID 106445158) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is N-ethyl-3-methyl-1-(4-methylthiomorpholin-3-yl)but-2-en-1-amine.
| Compound Name | N-ethyl-3-methyl-1-(4-methylthiomorpholin-3-yl)but-2-en-1-amine |
|---|---|
| PubChem CID | 106445158 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | N-ethyl-3-methyl-1-(4-methylthiomorpholin-3-yl)but-2-en-1-amine |
| SMILES | CCNC(C=C(C)C)C1CSCCN1C |
| InChI | InChI=1S/C12H24N2S/c1-5-13-11(8-10(2)3)12-9-15-7-6-14(12)4/h8,11-13H,5-7,9H2,1-4H3 |
| InChIKey | VQQMOUOSDDFUDB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|