About 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate
2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate (PubChem CID 106448275) has the molecular formula C10H21NO3
and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate.
Molecular Properties
| Compound Name | 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate |
| PubChem CID | 106448275 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate |
| SMILES | CCNCC(=O)OCCOCC(C)C |
| InChI | InChI=1S/C10H21NO3/c1-4-11-7-10(12)14-6-5-13-8-9(2)3/h9,11H,4-8H2,1-3H3 |
| InChIKey | JWNRHUHZKGHFGQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate?
The IUPAC name of 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate (CID 106448275) is 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate.
What is the SMILES notation for 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate?
The canonical SMILES for 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate is CCNCC(=O)OCCOCC(C)C.
What is the InChIKey of 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate?
The InChIKey is JWNRHUHZKGHFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3/c1-4-11-7-10(12)14-6-5-13-8-9(2)3/h9,11H,4-8H2,1-3H3.
What are the key properties of 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate?
2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate has a molecular weight of 203.28 g/mol, XLogP of 0.81, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropoxy)ethyl 2-(ethylamino)acetate is sourced from PubChem (CID 106448275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).