About 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one (PubChem CID 10645038) has the molecular formula C23H26N4OS
and a molecular weight of 406.56 g/mol. Its IUPAC name is 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one.
Molecular Properties
| Compound Name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one |
| PubChem CID | 10645038 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one |
| SMILES | CCN1C(=O)Cc2cc(CCN3CCN(c4nsc5ccccc45)CC3)ccc21 |
| InChI | InChI=1S/C23H26N4OS/c1-2-27-20-8-7-17(15-18(20)16-22(27)28)9-10-25-11-13-26(14-12-25)23-19-5-3-4-6-21(19)29-24-23/h3-8,15H,2,9-14,16H2,1H3 |
| InChIKey | UDHCGLWDZIOGOU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one?
The IUPAC name of 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one (CID 10645038) is 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one.
What is the SMILES notation for 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one?
The canonical SMILES for 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one is CCN1C(=O)Cc2cc(CCN3CCN(c4nsc5ccccc45)CC3)ccc21.
What is the InChIKey of 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one?
The InChIKey is UDHCGLWDZIOGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4OS/c1-2-27-20-8-7-17(15-18(20)16-22(27)28)9-10-25-11-13-26(14-12-25)23-19-5-3-4-6-21(19)29-24-23/h3-8,15H,2,9-14,16H2,1H3.
What are the key properties of 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one?
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one has a molecular weight of 406.56 g/mol, XLogP of 3.57, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1-ethyl-3H-indol-2-one is sourced from PubChem (CID 10645038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).