C25H46O2Si — CID 10645050
(1S,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentan-1-ol (PubChem CID 10645050) has the molecular formula C25H46O2Si and a molecular weight of 406.73 g/mol. Its IUPAC name is (1S,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentan-1-ol.
| Compound Name | (1S,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 10645050 |
| Molecular Formula | C25H46O2Si |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (1S,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentan-1-ol |
| SMILES | CCCCCCC/C=C/C=C(C)/C=C/[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C25H46O2Si/c1-8-9-10-11-12-13-14-15-16-21(2)17-18-22-19-23(20-24(22)26)27-28(6,7)25(3,4)5/h14-18,22-24,26H,8-13,19-20H2,1-7H3/b15-14+,18-17+,21-16+/t22-,23-,24-/m0/s1 |
| InChIKey | QVAKAOBHYMKXCN-FDPXEKMISA-N |
| XLogP | 7.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|