C12H28N2O — CID 106451802
1-N,1-N,3-trimethyl-2-N-(2-propoxyethyl)butane-1,2-diamine (PubChem CID 106451802) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-N,1-N,3-trimethyl-2-N-(2-propoxyethyl)butane-1,2-diamine.
| Compound Name | 1-N,1-N,3-trimethyl-2-N-(2-propoxyethyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 106451802 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 1-N,1-N,3-trimethyl-2-N-(2-propoxyethyl)butane-1,2-diamine |
| SMILES | CCCOCCNC(CN(C)C)C(C)C |
| InChI | InChI=1S/C12H28N2O/c1-6-8-15-9-7-13-12(11(2)3)10-14(4)5/h11-13H,6-10H2,1-5H3 |
| InChIKey | KMLVZEPYCPEZBB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|