C14H29NO — CID 106452198
2-(2-methylpropoxy)-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine (PubChem CID 106452198) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-(2-methylpropoxy)-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine.
| Compound Name | 2-(2-methylpropoxy)-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106452198 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-(2-methylpropoxy)-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine |
| SMILES | CC(C)COCCNCC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H29NO/c1-11(2)10-16-8-7-15-9-12-13(3,4)14(12,5)6/h11-12,15H,7-10H2,1-6H3 |
| InChIKey | YCLQYSIYNIDPPT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|