C24H28O6 — CID 10645355
(3S,4R,5R)-3-(2,4-dihydroxybenzoyl)-4,5-dimethyl-5-[(E)-4-methyl-5-(4-methylfuran-2-yl)pent-3-enyl]oxolan-2-one (PubChem CID 10645355) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (3S,4R,5R)-3-(2,4-dihydroxybenzoyl)-4,5-dimethyl-5-[(E)-4-methyl-5-(4-methylfuran-2-yl)pent-3-enyl]oxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(2,4-dihydroxybenzoyl)-4,5-dimethyl-5-[(E)-4-methyl-5-(4-methylfuran-2-yl)pent-3-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 10645355 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (3S,4R,5R)-3-(2,4-dihydroxybenzoyl)-4,5-dimethyl-5-[(E)-4-methyl-5-(4-methylfuran-2-yl)pent-3-enyl]oxolan-2-one |
| SMILES | C/C(=C\CC[C@@]1(C)OC(=O)[C@H](C(=O)c2ccc(O)cc2O)[C@H]1C)Cc1cc(C)co1 |
| InChI | InChI=1S/C24H28O6/c1-14(10-18-11-15(2)13-29-18)6-5-9-24(4)16(3)21(23(28)30-24)22(27)19-8-7-17(25)12-20(19)26/h6-8,11-13,16,21,25-26H,5,9-10H2,1-4H3/b14-6+/t16-,21+,24-/m1/s1 |
| InChIKey | IVRBZHGZUKMJJC-RYLLUPBGSA-N |
| XLogP | 4.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|