C9H12Cl2N2O2 — CID 106455823
5,6-dichloro-3-(2-propoxyethyl)pyrimidin-4-one (PubChem CID 106455823) has the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. Its IUPAC name is 5,6-dichloro-3-(2-propoxyethyl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(2-propoxyethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 106455823 |
| Molecular Formula | C9H12Cl2N2O2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5,6-dichloro-3-(2-propoxyethyl)pyrimidin-4-one |
| SMILES | CCCOCCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C9H12Cl2N2O2/c1-2-4-15-5-3-13-6-12-8(11)7(10)9(13)14/h6H,2-5H2,1H3 |
| InChIKey | DXDFVUWKDGQMDK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|