C20H18Cl2N4S — CID 10645615
8-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 10645615) has the molecular formula C20H18Cl2N4S and a molecular weight of 417.37 g/mol. Its IUPAC name is 8-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 8-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 10645615 |
| Molecular Formula | C20H18Cl2N4S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 8-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | Clc1ccc(CN2CCN(c3nc4ccsc4n4cccc34)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N4S/c21-15-4-3-14(16(22)12-15)13-24-7-9-25(10-8-24)19-18-2-1-6-26(18)20-17(23-19)5-11-27-20/h1-6,11-12H,7-10,13H2 |
| InChIKey | ZDPNKNSRWQOPMC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |