C13H19NO — CID 106458136
1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole (PubChem CID 106458136) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 106458136 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole |
| SMILES | CCCOCCC1NCc2ccccc21 |
| InChI | InChI=1S/C13H19NO/c1-2-8-15-9-7-13-12-6-4-3-5-11(12)10-14-13/h3-6,13-14H,2,7-10H2,1H3 |
| InChIKey | REKNEINQQYFYQU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|