About 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole
1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole (PubChem CID 106458136) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole |
| PubChem CID | 106458136 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole |
| SMILES | CCCOCCC1NCc2ccccc21 |
| InChI | InChI=1S/C13H19NO/c1-2-8-15-9-7-13-12-6-4-3-5-11(12)10-14-13/h3-6,13-14H,2,7-10H2,1H3 |
| InChIKey | REKNEINQQYFYQU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole?
The IUPAC name of 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole (CID 106458136) is 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole?
The canonical SMILES for 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole is CCCOCCC1NCc2ccccc21.
What is the InChIKey of 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole?
The InChIKey is REKNEINQQYFYQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-2-8-15-9-7-13-12-6-4-3-5-11(12)10-14-13/h3-6,13-14H,2,7-10H2,1H3.
What are the key properties of 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole?
1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole has a molecular weight of 205.30 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-propoxyethyl)-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 106458136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).