C25H44O3Si — CID 10645825
methyl (2E,4E,8E,10E,14S)-7-[tert-butyl(dimethyl)silyl]oxy-8,14-dimethylhexadeca-2,4,8,10-tetraenoate (PubChem CID 10645825) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is methyl (2E,4E,8E,10E,14S)-7-[tert-butyl(dimethyl)silyl]oxy-8,14-dimethylhexadeca-2,4,8,10-tetraenoate.
| Compound Name | methyl (2E,4E,8E,10E,14S)-7-[tert-butyl(dimethyl)silyl]oxy-8,14-dimethylhexadeca-2,4,8,10-tetraenoate |
|---|---|
| PubChem CID | 10645825 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | methyl (2E,4E,8E,10E,14S)-7-[tert-butyl(dimethyl)silyl]oxy-8,14-dimethylhexadeca-2,4,8,10-tetraenoate |
| SMILES | CC[C@H](C)CC/C=C/C=C(\C)C(C/C=C/C=C/C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O3Si/c1-10-21(2)17-13-11-14-18-22(3)23(28-29(8,9)25(4,5)6)19-15-12-16-20-24(26)27-7/h11-12,14-16,18,20-21,23H,10,13,17,19H2,1-9H3/b14-11+,15-12+,20-16+,22-18+/t21-,23?/m0/s1 |
| InChIKey | CYVQVGHRUKNMBN-BYBBSCLKSA-N |
| XLogP | 7.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|