C16H34N2O — CID 106458706
2-tert-butyl-5-ethyl-5-methyl-1-(2-propoxyethyl)piperazine (PubChem CID 106458706) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-tert-butyl-5-ethyl-5-methyl-1-(2-propoxyethyl)piperazine.
| Compound Name | 2-tert-butyl-5-ethyl-5-methyl-1-(2-propoxyethyl)piperazine |
|---|---|
| PubChem CID | 106458706 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 2-tert-butyl-5-ethyl-5-methyl-1-(2-propoxyethyl)piperazine |
| SMILES | CCCOCCN1CC(C)(CC)NCC1C(C)(C)C |
| InChI | InChI=1S/C16H34N2O/c1-7-10-19-11-9-18-13-16(6,8-2)17-12-14(18)15(3,4)5/h14,17H,7-13H2,1-6H3 |
| InChIKey | KXOAQPDBUIRZQG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|