C25H44OS2 — CID 10646033
2-[(E)-12,13-bis(methylsulfanyl)nonadec-1-enyl]furan (PubChem CID 10646033) has the molecular formula C25H44OS2 and a molecular weight of 424.76 g/mol. Its IUPAC name is 2-[(E)-12,13-bis(methylsulfanyl)nonadec-1-enyl]furan.
| Compound Name | 2-[(E)-12,13-bis(methylsulfanyl)nonadec-1-enyl]furan |
|---|---|
| PubChem CID | 10646033 |
| Molecular Formula | C25H44OS2 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 2-[(E)-12,13-bis(methylsulfanyl)nonadec-1-enyl]furan |
| SMILES | CCCCCCC(SC)C(CCCCCCCCC/C=C/c1ccco1)SC |
| InChI | InChI=1S/C25H44OS2/c1-4-5-6-15-20-24(27-2)25(28-3)21-16-13-11-9-7-8-10-12-14-18-23-19-17-22-26-23/h14,17-19,22,24-25H,4-13,15-16,20-21H2,1-3H3/b18-14+ |
| InChIKey | FRWAYEQTYJBZAD-NBVRZTHBSA-N |
| XLogP | 9.24 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|