C15H17ClN2OS — CID 106460972
3-chloro-9,13-dimethyl-10-prop-2-enyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione (PubChem CID 106460972) has the molecular formula C15H17ClN2OS and a molecular weight of 308.83 g/mol. Its IUPAC name is 3-chloro-9,13-dimethyl-10-prop-2-enyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione.
| Compound Name | 3-chloro-9,13-dimethyl-10-prop-2-enyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
|---|---|
| PubChem CID | 106460972 |
| Molecular Formula | C15H17ClN2OS |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-chloro-9,13-dimethyl-10-prop-2-enyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
| SMILES | C=CCN1C(=S)NC2c3c(Cl)cccc3OC1(C)C2C |
| InChI | InChI=1S/C15H17ClN2OS/c1-4-8-18-14(20)17-13-9(2)15(18,3)19-11-7-5-6-10(16)12(11)13/h4-7,9,13H,1,8H2,2-3H3,(H,17,20) |
| InChIKey | SBRKXPWMOCMPDM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|