C11H9BrF3N3O2 — CID 106461188
(5-bromo-3-methyltriazol-4-yl)-[2-(trifluoromethoxy)phenyl]methanol (PubChem CID 106461188) has the molecular formula C11H9BrF3N3O2 and a molecular weight of 352.11 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-[2-(trifluoromethoxy)phenyl]methanol.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-[2-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 106461188 |
| Molecular Formula | C11H9BrF3N3O2 |
| Molecular Weight | 352.11 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-[2-(trifluoromethoxy)phenyl]methanol |
| SMILES | Cn1nnc(Br)c1C(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C11H9BrF3N3O2/c1-18-8(10(12)16-17-18)9(19)6-4-2-3-5-7(6)20-11(13,14)15/h2-5,9,19H,1H3 |
| InChIKey | QBDOTJJRSACSHH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.11 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |