About 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate
2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate (PubChem CID 10646125) has the molecular formula C20H20Cl2O6
and a molecular weight of 427.28 g/mol. Its IUPAC name is 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate |
| PubChem CID | 10646125 |
| Molecular Formula | C20H20Cl2O6 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate |
| SMILES | CC1(O)OOC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)CC1C(=O)OCCO |
| InChI | InChI=1S/C20H20Cl2O6/c1-19(25)17(18(24)26-11-10-23)12-20(28-27-19,13-2-6-15(21)7-3-13)14-4-8-16(22)9-5-14/h2-9,17,23,25H,10-12H2,1H3 |
| InChIKey | YAHOPAITPSSRGN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate?
The IUPAC name of 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate (CID 10646125) is 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate?
The canonical SMILES for 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate is CC1(O)OOC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)CC1C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate?
The InChIKey is YAHOPAITPSSRGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2O6/c1-19(25)17(18(24)26-11-10-23)12-20(28-27-19,13-2-6-15(21)7-3-13)14-4-8-16(22)9-5-14/h2-9,17,23,25H,10-12H2,1H3.
What are the key properties of 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate?
2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate has a molecular weight of 427.28 g/mol, XLogP of 3.45, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate is sourced from PubChem (CID 10646125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).