C12H16BrN3OS — CID 106461340
(5-bromo-3-methyltriazol-4-yl)-(5-tert-butylthiophen-2-yl)methanol (PubChem CID 106461340) has the molecular formula C12H16BrN3OS and a molecular weight of 330.25 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(5-tert-butylthiophen-2-yl)methanol.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(5-tert-butylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 106461340 |
| Molecular Formula | C12H16BrN3OS |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(5-tert-butylthiophen-2-yl)methanol |
| SMILES | Cn1nnc(Br)c1C(O)c1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C12H16BrN3OS/c1-12(2,3)8-6-5-7(18-8)10(17)9-11(13)14-15-16(9)4/h5-6,10,17H,1-4H3 |
| InChIKey | QCSHFLMZXQHGHR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |