C10H10F9I — CID 10646165
(E)-6,6,7,7,8,8,9,9,9-nonafluoro-4-iodo-5-methylnon-4-ene (PubChem CID 10646165) has the molecular formula C10H10F9I and a molecular weight of 428.08 g/mol. Its IUPAC name is (E)-6,6,7,7,8,8,9,9,9-nonafluoro-4-iodo-5-methylnon-4-ene.
| Compound Name | (E)-6,6,7,7,8,8,9,9,9-nonafluoro-4-iodo-5-methylnon-4-ene |
|---|---|
| PubChem CID | 10646165 |
| Molecular Formula | C10H10F9I |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | (E)-6,6,7,7,8,8,9,9,9-nonafluoro-4-iodo-5-methylnon-4-ene |
| SMILES | CCC/C(I)=C(/C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F9I/c1-3-4-6(20)5(2)7(11,12)8(13,14)9(15,16)10(17,18)19/h3-4H2,1-2H3/b6-5+ |
| InChIKey | UNJBGNHGNHHMHY-AATRIKPKSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|