C23H48O3Si2 — CID 10646220
3-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylcyclohexyl]propanal (PubChem CID 10646220) has the molecular formula C23H48O3Si2 and a molecular weight of 428.81 g/mol. Its IUPAC name is 3-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylcyclohexyl]propanal.
| Compound Name | 3-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylcyclohexyl]propanal |
|---|---|
| PubChem CID | 10646220 |
| Molecular Formula | C23H48O3Si2 |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 3-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylcyclohexyl]propanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]1(C)CCC=O |
| InChI | InChI=1S/C23H48O3Si2/c1-21(2,3)27(8,9)25-18-19-20(26-28(10,11)22(4,5)6)14-12-15-23(19,7)16-13-17-24/h17,19-20H,12-16,18H2,1-11H3/t19-,20-,23+/m1/s1 |
| InChIKey | QBYMQHVAINAYAB-VIZSFHNOSA-N |
| XLogP | 7.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|