C16H9BrF4N4O — CID 10646229
N-[4-[5-bromo-3-(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluoropyridine-4-carboxamide (PubChem CID 10646229) has the molecular formula C16H9BrF4N4O and a molecular weight of 429.17 g/mol. Its IUPAC name is N-[4-[5-bromo-3-(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[4-[5-bromo-3-(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 10646229 |
| Molecular Formula | C16H9BrF4N4O |
| Molecular Weight | 429.17 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | N-[4-[5-bromo-3-(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2Br)cc1)c1ccncc1F |
| InChI | InChI=1S/C16H9BrF4N4O/c17-14-7-13(16(19,20)21)24-25(14)10-3-1-9(2-4-10)23-15(26)11-5-6-22-8-12(11)18/h1-8H,(H,23,26) |
| InChIKey | CGFLXAHWZOODHH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.17 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |