C13H24BrN5 — CID 106462639
1-(5-bromo-3-methyltriazol-4-yl)-2-methyl-2-piperidin-1-ylbutan-1-amine (PubChem CID 106462639) has the molecular formula C13H24BrN5 and a molecular weight of 330.27 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-2-methyl-2-piperidin-1-ylbutan-1-amine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-methyl-2-piperidin-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 106462639 |
| Molecular Formula | C13H24BrN5 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-methyl-2-piperidin-1-ylbutan-1-amine |
| SMILES | CCC(C)(C(N)c1c(Br)nnn1C)N1CCCCC1 |
| InChI | InChI=1S/C13H24BrN5/c1-4-13(2,19-8-6-5-7-9-19)11(15)10-12(14)16-17-18(10)3/h11H,4-9,15H2,1-3H3 |
| InChIKey | YHXYLRPLAORKQR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |