C16H20Cl4O3Si — CID 10646270
2-methyl-6-(2,3,5,6-tetrachloro-4-trimethylsilyloxyphenoxy)cyclohexan-1-one (PubChem CID 10646270) has the molecular formula C16H20Cl4O3Si and a molecular weight of 430.23 g/mol. Its IUPAC name is 2-methyl-6-(2,3,5,6-tetrachloro-4-trimethylsilyloxyphenoxy)cyclohexan-1-one.
| Compound Name | 2-methyl-6-(2,3,5,6-tetrachloro-4-trimethylsilyloxyphenoxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 10646270 |
| Molecular Formula | C16H20Cl4O3Si |
| Molecular Weight | 430.23 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 2-methyl-6-(2,3,5,6-tetrachloro-4-trimethylsilyloxyphenoxy)cyclohexan-1-one |
| SMILES | CC1CCCC(Oc2c(Cl)c(Cl)c(O[Si](C)(C)C)c(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C16H20Cl4O3Si/c1-8-6-5-7-9(14(8)21)22-15-10(17)12(19)16(13(20)11(15)18)23-24(2,3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | AZJIQSCEUJOZOO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.23 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|