C21H16F2N2O6 — CID 10646275
[(1R,4S)-3-(4-fluoro-3-nitrobenzoyl)-2-bicyclo[2.2.1]heptanyl]-(4-fluoro-3-nitrophenyl)methanone (PubChem CID 10646275) has the molecular formula C21H16F2N2O6 and a molecular weight of 430.36 g/mol. Its IUPAC name is [(1R,4S)-3-(4-fluoro-3-nitrobenzoyl)-2-bicyclo[2.2.1]heptanyl]-(4-fluoro-3-nitrophenyl)methanone.
| Compound Name | [(1R,4S)-3-(4-fluoro-3-nitrobenzoyl)-2-bicyclo[2.2.1]heptanyl]-(4-fluoro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 10646275 |
| Molecular Formula | C21H16F2N2O6 |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [(1R,4S)-3-(4-fluoro-3-nitrobenzoyl)-2-bicyclo[2.2.1]heptanyl]-(4-fluoro-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(F)c([N+](=O)[O-])c1)C1C(C(=O)c2ccc(F)c([N+](=O)[O-])c2)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C21H16F2N2O6/c22-14-5-3-12(8-16(14)24(28)29)20(26)18-10-1-2-11(7-10)19(18)21(27)13-4-6-15(23)17(9-13)25(30)31/h3-6,8-11,18-19H,1-2,7H2/t10-,11+,18?,19? |
| InChIKey | RHVTXQPJURRBAT-PPFQZGAJSA-N |
| XLogP | 4.51 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|